![[2-[(2-chlorophenyl)methoxy]phenyl]boronic acid (CAS: 870777-21-2) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0752169.png "[2-[(2-chlorophenyl)methoxy]phenyl]boronic acid chemical structure")
[2-[(2-chlorophenyl)methoxy]phenyl]boronic acid
Catalog No: FT-0752169
CAS No: 870777-21-2
- Chemical Name: [2-[(2-chlorophenyl)methoxy]phenyl]boronic acid
- Molecular Formula: C13H12BClO3
- Molecular Weight: 262.5
- InChI Key: OOORTTOHYXWCDV-UHFFFAOYSA-N
- InChI: InChI=1S/C13H12BClO3/c15-12-7-3-1-5-10(12)9-18-13-8-4-2-6-11(13)14(16)17/h1-8,16-17H,9H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 454.8ºC at 760 mmHg |
|---|---|
| CAS: | 870777-21-2 |
| MF: | C13H12BClO3 |
| Density: | 1.3g/cm3 |
| Melting_Point: | 124-129ºC(lit.) |
| Product_Name: | [2-[(2-chlorophenyl)methoxy]phenyl]boronic acid |
| Flash_Point: | 228.9ºC |
| FW: | 262.49700 |
| Density: | 1.3g/cm3 |
|---|---|
| MF: | C13H12BClO3 |
| LogP: | 1.59880 |
| Melting_Point: | 124-129ºC(lit.) |
| Exact_Mass: | 262.05700 |
| Bolling_Point: | 454.8ºC at 760 mmHg |
| Flash_Point: | 228.9ºC |
| FW: | 262.49700 |
| Refractive_Index: | 1.605 |
| PSA: | 49.69000 |
| HS_Code: | 2931900090 |
|---|---|
| RIDADR: | NONH for all modes of transport |
![2-[4-[(dimethylamino)methyl]phenyl]acetic acid (CAS: 99985-52-1) - Related Chemical Product](/static/img/prod_pic/FT-0737063.png "2-[4-[(dimethylamino)methyl]phenyl]acetic acid chemical structure")
![2-[2-hydroxyethyl-[(4-nitrophenyl)methyl]amino]ethanol (CAS: 99982-60-2) - Related Chemical Product](/static/img/prod_pic/FT-0749988.png "2-[2-hydroxyethyl-[(4-nitrophenyl)methyl]amino]ethanol chemical structure")
